C21H14ClNO2S2 — CID 3762503
[1,3-benzothiazol-2-ylsulfanyl(phenyl)methyl] 4-chlorobenzoate (PubChem CID 3762503) has the molecular formula C21H14ClNO2S2 and a molecular weight of 411.94 g/mol. Its IUPAC name is [1,3-benzothiazol-2-ylsulfanyl(phenyl)methyl] 4-chlorobenzoate.
| Compound Name | [1,3-benzothiazol-2-ylsulfanyl(phenyl)methyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 3762503 |
| Molecular Formula | C21H14ClNO2S2 |
| Molecular Weight | 411.94 g/mol |
| Exact Mass | 411.02 |
| IUPAC Name | [1,3-benzothiazol-2-ylsulfanyl(phenyl)methyl] 4-chlorobenzoate |
| SMILES | O=C(OC(Sc1nc2ccccc2s1)c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H14ClNO2S2/c22-16-12-10-14(11-13-16)19(24)25-20(15-6-2-1-3-7-15)27-21-23-17-8-4-5-9-18(17)26-21/h1-13,20H |
| InChIKey | HESRHFQWBCKQES-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.94 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|