C16H12N2O4S2 — CID 1416705
[(S)-(6-nitro-1,3-benzothiazol-2-yl)sulfanyl-phenylmethyl] acetate (PubChem CID 1416705) has the molecular formula C16H12N2O4S2 and a molecular weight of 360.42 g/mol. Its IUPAC name is [(S)-(6-nitro-1,3-benzothiazol-2-yl)sulfanyl-phenylmethyl] acetate.
| Compound Name | [(S)-(6-nitro-1,3-benzothiazol-2-yl)sulfanyl-phenylmethyl] acetate |
|---|---|
| PubChem CID | 1416705 |
| Molecular Formula | C16H12N2O4S2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | [(S)-(6-nitro-1,3-benzothiazol-2-yl)sulfanyl-phenylmethyl] acetate |
| SMILES | CC(=O)O[C@@H](Sc1nc2ccc([N+](=O)[O-])cc2s1)c1ccccc1 |
| InChI | InChI=1S/C16H12N2O4S2/c1-10(19)22-15(11-5-3-2-4-6-11)24-16-17-13-8-7-12(18(20)21)9-14(13)23-16/h2-9,15H,1H3/t15-/m0/s1 |
| InChIKey | ZHNIXXNROSSAPL-HNNXBMFYSA-N |
| XLogP | 4.56 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|