C15H12N2O5S2 — CID 47026117
methyl 5-[1-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]ethyl]furan-2-carboxylate (PubChem CID 47026117) has the molecular formula C15H12N2O5S2 and a molecular weight of 364.40 g/mol. Its IUPAC name is methyl 5-[1-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]ethyl]furan-2-carboxylate.
| Compound Name | methyl 5-[1-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]ethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 47026117 |
| Molecular Formula | C15H12N2O5S2 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | methyl 5-[1-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]ethyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(C(C)Sc2nc3ccc([N+](=O)[O-])cc3s2)o1 |
| InChI | InChI=1S/C15H12N2O5S2/c1-8(11-5-6-12(22-11)14(18)21-2)23-15-16-10-4-3-9(17(19)20)7-13(10)24-15/h3-8H,1-2H3 |
| InChIKey | BPWZJVYTGBBFPQ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 95.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|