C16H11FN2O3S2 — CID 8916219
(2S)-1-(4-fluorophenyl)-2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]propan-1-one (PubChem CID 8916219) has the molecular formula C16H11FN2O3S2 and a molecular weight of 362.41 g/mol. Its IUPAC name is (2S)-1-(4-fluorophenyl)-2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]propan-1-one.
| Compound Name | (2S)-1-(4-fluorophenyl)-2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]propan-1-one |
|---|---|
| PubChem CID | 8916219 |
| Molecular Formula | C16H11FN2O3S2 |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | (2S)-1-(4-fluorophenyl)-2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]propan-1-one |
| SMILES | C[C@H](Sc1nc2ccc([N+](=O)[O-])cc2s1)C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H11FN2O3S2/c1-9(15(20)10-2-4-11(17)5-3-10)23-16-18-13-7-6-12(19(21)22)8-14(13)24-16/h2-9H,1H3/t9-/m0/s1 |
| InChIKey | CQDCTCPQKLRVLY-VIFPVBQESA-N |
| XLogP | 4.71 |
| TPSA | 73.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|