C17H12N4O3S2 — CID 7854281
(2S)-N-(3-cyanophenyl)-2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]propanamide (PubChem CID 7854281) has the molecular formula C17H12N4O3S2 and a molecular weight of 384.44 g/mol. Its IUPAC name is (2S)-N-(3-cyanophenyl)-2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]propanamide.
| Compound Name | (2S)-N-(3-cyanophenyl)-2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 7854281 |
| Molecular Formula | C17H12N4O3S2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | (2S)-N-(3-cyanophenyl)-2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]propanamide |
| SMILES | C[C@H](Sc1nc2ccc([N+](=O)[O-])cc2s1)C(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C17H12N4O3S2/c1-10(16(22)19-12-4-2-3-11(7-12)9-18)25-17-20-14-6-5-13(21(23)24)8-15(14)26-17/h2-8,10H,1H3,(H,19,22)/t10-/m0/s1 |
| InChIKey | JYDVCRGUJCFCFZ-JTQLQIEISA-N |
| XLogP | 4.20 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|