C20H20N4O4S2 — CID 2951620
N-(3-nitrophenyl)-2-[[6-(propanoylamino)-1,3-benzothiazol-2-yl]sulfanyl]butanamide (PubChem CID 2951620) has the molecular formula C20H20N4O4S2 and a molecular weight of 444.54 g/mol. Its IUPAC name is N-(3-nitrophenyl)-2-[[6-(propanoylamino)-1,3-benzothiazol-2-yl]sulfanyl]butanamide.
| Compound Name | N-(3-nitrophenyl)-2-[[6-(propanoylamino)-1,3-benzothiazol-2-yl]sulfanyl]butanamide |
|---|---|
| PubChem CID | 2951620 |
| Molecular Formula | C20H20N4O4S2 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | N-(3-nitrophenyl)-2-[[6-(propanoylamino)-1,3-benzothiazol-2-yl]sulfanyl]butanamide |
| SMILES | CCC(=O)Nc1ccc2nc(SC(CC)C(=O)Nc3cccc([N+](=O)[O-])c3)sc2c1 |
| InChI | InChI=1S/C20H20N4O4S2/c1-3-16(19(26)22-12-6-5-7-14(10-12)24(27)28)29-20-23-15-9-8-13(11-17(15)30-20)21-18(25)4-2/h5-11,16H,3-4H2,1-2H3,(H,21,25)(H,22,26) |
| InChIKey | HLHMYJQROATOGE-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|