C24H19ClN4O4S2 — CID 23997863
2-chloro-N-[2-[1-(3-nitroanilino)-1-oxobutan-2-yl]sulfanyl-1,3-benzothiazol-6-yl]benzamide (PubChem CID 23997863) has the molecular formula C24H19ClN4O4S2 and a molecular weight of 527.03 g/mol. Its IUPAC name is 2-chloro-N-[2-[1-(3-nitroanilino)-1-oxobutan-2-yl]sulfanyl-1,3-benzothiazol-6-yl]benzamide.
| Compound Name | 2-chloro-N-[2-[1-(3-nitroanilino)-1-oxobutan-2-yl]sulfanyl-1,3-benzothiazol-6-yl]benzamide |
|---|---|
| PubChem CID | 23997863 |
| Molecular Formula | C24H19ClN4O4S2 |
| Molecular Weight | 527.03 g/mol |
| Exact Mass | 526.05 |
| IUPAC Name | 2-chloro-N-[2-[1-(3-nitroanilino)-1-oxobutan-2-yl]sulfanyl-1,3-benzothiazol-6-yl]benzamide |
| SMILES | CCC(Sc1nc2ccc(NC(=O)c3ccccc3Cl)cc2s1)C(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H19ClN4O4S2/c1-2-20(23(31)27-14-6-5-7-16(12-14)29(32)33)34-24-28-19-11-10-15(13-21(19)35-24)26-22(30)17-8-3-4-9-18(17)25/h3-13,20H,2H2,1H3,(H,26,30)(H,27,31) |
| InChIKey | JVCHKGMYOCQGEM-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.03 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|