C25H23N7O3S — CID 21371577
2-[(4,6-dianilino-1,3,5-triazin-2-yl)sulfanyl]-N-(3-nitrophenyl)butanamide (PubChem CID 21371577) has the molecular formula C25H23N7O3S and a molecular weight of 501.57 g/mol. Its IUPAC name is 2-[(4,6-dianilino-1,3,5-triazin-2-yl)sulfanyl]-N-(3-nitrophenyl)butanamide.
| Compound Name | 2-[(4,6-dianilino-1,3,5-triazin-2-yl)sulfanyl]-N-(3-nitrophenyl)butanamide |
|---|---|
| PubChem CID | 21371577 |
| Molecular Formula | C25H23N7O3S |
| Molecular Weight | 501.57 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | 2-[(4,6-dianilino-1,3,5-triazin-2-yl)sulfanyl]-N-(3-nitrophenyl)butanamide |
| SMILES | CCC(Sc1nc(Nc2ccccc2)nc(Nc2ccccc2)n1)C(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H23N7O3S/c1-2-21(22(33)26-19-14-9-15-20(16-19)32(34)35)36-25-30-23(27-17-10-5-3-6-11-17)29-24(31-25)28-18-12-7-4-8-13-18/h3-16,21H,2H2,1H3,(H,26,33)(H2,27,28,29,30,31) |
| InChIKey | JZNZTCRWFPPPMC-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 134.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.57 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|