C19H19N3O2S2 — CID 3151291
N-(4-acetylphenyl)-2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]butanamide (PubChem CID 3151291) has the molecular formula C19H19N3O2S2 and a molecular weight of 385.51 g/mol. Its IUPAC name is N-(4-acetylphenyl)-2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]butanamide.
| Compound Name | N-(4-acetylphenyl)-2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]butanamide |
|---|---|
| PubChem CID | 3151291 |
| Molecular Formula | C19H19N3O2S2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | N-(4-acetylphenyl)-2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]butanamide |
| SMILES | CCC(Sc1nc2ccc(N)cc2s1)C(=O)Nc1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C19H19N3O2S2/c1-3-16(18(24)21-14-7-4-12(5-8-14)11(2)23)25-19-22-15-9-6-13(20)10-17(15)26-19/h4-10,16H,3,20H2,1-2H3,(H,21,24) |
| InChIKey | OMXKVJCHPLFHRE-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|