C14H17N5O2S — CID 660696
N-(4-acetylphenyl)-2-(1-methyltetrazol-5-yl)sulfanylbutanamide (PubChem CID 660696) has the molecular formula C14H17N5O2S and a molecular weight of 319.39 g/mol. Its IUPAC name is N-(4-acetylphenyl)-2-(1-methyltetrazol-5-yl)sulfanylbutanamide.
| Compound Name | N-(4-acetylphenyl)-2-(1-methyltetrazol-5-yl)sulfanylbutanamide |
|---|---|
| PubChem CID | 660696 |
| Molecular Formula | C14H17N5O2S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | N-(4-acetylphenyl)-2-(1-methyltetrazol-5-yl)sulfanylbutanamide |
| SMILES | CCC(Sc1nnnn1C)C(=O)Nc1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C14H17N5O2S/c1-4-12(22-14-16-17-18-19(14)3)13(21)15-11-7-5-10(6-8-11)9(2)20/h5-8,12H,4H2,1-3H3,(H,15,21) |
| InChIKey | MKCJYSSNZZGXFW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |