C19H22N4O3S — CID 7220191
(2R)-N-(4-acetylphenyl)-2-(6-amino-4-oxo-1-prop-2-enylpyrimidin-2-yl)sulfanylbutanamide (PubChem CID 7220191) has the molecular formula C19H22N4O3S and a molecular weight of 386.48 g/mol. Its IUPAC name is (2R)-N-(4-acetylphenyl)-2-(6-amino-4-oxo-1-prop-2-enylpyrimidin-2-yl)sulfanylbutanamide.
| Compound Name | (2R)-N-(4-acetylphenyl)-2-(6-amino-4-oxo-1-prop-2-enylpyrimidin-2-yl)sulfanylbutanamide |
|---|---|
| PubChem CID | 7220191 |
| Molecular Formula | C19H22N4O3S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | (2R)-N-(4-acetylphenyl)-2-(6-amino-4-oxo-1-prop-2-enylpyrimidin-2-yl)sulfanylbutanamide |
| SMILES | C=CCn1c(N)cc(=O)nc1S[C@H](CC)C(=O)Nc1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C19H22N4O3S/c1-4-10-23-16(20)11-17(25)22-19(23)27-15(5-2)18(26)21-14-8-6-13(7-9-14)12(3)24/h4,6-9,11,15H,1,5,10,20H2,2-3H3,(H,21,26)/t15-/m1/s1 |
| InChIKey | XPEAMDIVZWTTQB-OAHLLOKOSA-N |
| XLogP | 2.72 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|