C19H15ClN2O2S2 — CID 90574743
2-(1,3-benzothiazol-2-ylsulfanyl)-N-[4-(2-chlorophenoxy)but-2-ynyl]acetamide (PubChem CID 90574743) has the molecular formula C19H15ClN2O2S2 and a molecular weight of 402.93 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[4-(2-chlorophenoxy)but-2-ynyl]acetamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[4-(2-chlorophenoxy)but-2-ynyl]acetamide |
|---|---|
| PubChem CID | 90574743 |
| Molecular Formula | C19H15ClN2O2S2 |
| Molecular Weight | 402.93 g/mol |
| Exact Mass | 402.03 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[4-(2-chlorophenoxy)but-2-ynyl]acetamide |
| SMILES | O=C(CSc1nc2ccccc2s1)NCC#CCOc1ccccc1Cl |
| InChI | InChI=1S/C19H15ClN2O2S2/c20-14-7-1-3-9-16(14)24-12-6-5-11-21-18(23)13-25-19-22-15-8-2-4-10-17(15)26-19/h1-4,7-10H,11-13H2,(H,21,23) |
| InChIKey | RJLVBZMTCKHKRM-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.93 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|