C18H13ClN2OS2 — CID 90548578
2-(1,3-benzothiazol-2-ylsulfanyl)-N-[3-(2-chlorophenyl)prop-2-ynyl]acetamide (PubChem CID 90548578) has the molecular formula C18H13ClN2OS2 and a molecular weight of 372.90 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[3-(2-chlorophenyl)prop-2-ynyl]acetamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[3-(2-chlorophenyl)prop-2-ynyl]acetamide |
|---|---|
| PubChem CID | 90548578 |
| Molecular Formula | C18H13ClN2OS2 |
| Molecular Weight | 372.90 g/mol |
| Exact Mass | 372.02 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[3-(2-chlorophenyl)prop-2-ynyl]acetamide |
| SMILES | O=C(CSc1nc2ccccc2s1)NCC#Cc1ccccc1Cl |
| InChI | InChI=1S/C18H13ClN2OS2/c19-14-8-2-1-6-13(14)7-5-11-20-17(22)12-23-18-21-15-9-3-4-10-16(15)24-18/h1-4,6,8-10H,11-12H2,(H,20,22) |
| InChIKey | CUGYJPQXTGKOIN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.90 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|