C21H14N2S — CID 151910033
4-[4-(1,3-benzothiazol-2-yl)phenyl]-N-ethynylaniline (PubChem CID 151910033) has the molecular formula C21H14N2S and a molecular weight of 326.42 g/mol. Its IUPAC name is 4-[4-(1,3-benzothiazol-2-yl)phenyl]-N-ethynylaniline.
| Compound Name | 4-[4-(1,3-benzothiazol-2-yl)phenyl]-N-ethynylaniline |
|---|---|
| PubChem CID | 151910033 |
| Molecular Formula | C21H14N2S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 4-[4-(1,3-benzothiazol-2-yl)phenyl]-N-ethynylaniline |
| SMILES | C#CNc1ccc(-c2ccc(-c3nc4ccccc4s3)cc2)cc1 |
| InChI | InChI=1S/C21H14N2S/c1-2-22-18-13-11-16(12-14-18)15-7-9-17(10-8-15)21-23-19-5-3-4-6-20(19)24-21/h1,3-14,22H |
| InChIKey | SUOJVXHGYPGWRB-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|