C9H4F2N4O6 — CID 23354169
5,6-difluoro-2,4-dinitro-3-(nitromethyl)-1H-indole (PubChem CID 23354169) has the molecular formula C9H4F2N4O6 and a molecular weight of 302.15 g/mol. Its IUPAC name is 5,6-difluoro-2,4-dinitro-3-(nitromethyl)-1H-indole.
| Compound Name | 5,6-difluoro-2,4-dinitro-3-(nitromethyl)-1H-indole |
|---|---|
| PubChem CID | 23354169 |
| Molecular Formula | C9H4F2N4O6 |
| Molecular Weight | 302.15 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | 5,6-difluoro-2,4-dinitro-3-(nitromethyl)-1H-indole |
| SMILES | O=[N+]([O-])Cc1c([N+](=O)[O-])[nH]c2cc(F)c(F)c([N+](=O)[O-])c12 |
| InChI | InChI=1S/C9H4F2N4O6/c10-4-1-5-6(8(7(4)11)14(18)19)3(2-13(16)17)9(12-5)15(20)21/h1,12H,2H2 |
| InChIKey | UUFVXFQUHDCPSJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 145.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.15 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|