C10H6F2N2O4 — CID 23354429
2-(4,6-difluoro-2-nitro-1H-indol-3-yl)acetic acid (PubChem CID 23354429) has the molecular formula C10H6F2N2O4 and a molecular weight of 256.16 g/mol. Its IUPAC name is 2-(4,6-difluoro-2-nitro-1H-indol-3-yl)acetic acid.
| Compound Name | 2-(4,6-difluoro-2-nitro-1H-indol-3-yl)acetic acid |
|---|---|
| PubChem CID | 23354429 |
| Molecular Formula | C10H6F2N2O4 |
| Molecular Weight | 256.16 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | 2-(4,6-difluoro-2-nitro-1H-indol-3-yl)acetic acid |
| SMILES | O=C(O)Cc1c([N+](=O)[O-])[nH]c2cc(F)cc(F)c12 |
| InChI | InChI=1S/C10H6F2N2O4/c11-4-1-6(12)9-5(3-8(15)16)10(14(17)18)13-7(9)2-4/h1-2,13H,3H2,(H,15,16) |
| InChIKey | KRCOKXQIYPIZTF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.16 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|