C8H3Br2N3O5 — CID 23354069
5,6-dibromo-2,4-dinitro-1H-indol-3-ol (PubChem CID 23354069) has the molecular formula C8H3Br2N3O5 and a molecular weight of 380.94 g/mol. Its IUPAC name is 5,6-dibromo-2,4-dinitro-1H-indol-3-ol.
| Compound Name | 5,6-dibromo-2,4-dinitro-1H-indol-3-ol |
|---|---|
| PubChem CID | 23354069 |
| Molecular Formula | C8H3Br2N3O5 |
| Molecular Weight | 380.94 g/mol |
| Exact Mass | 378.84 |
| IUPAC Name | 5,6-dibromo-2,4-dinitro-1H-indol-3-ol |
| SMILES | O=[N+]([O-])c1[nH]c2cc(Br)c(Br)c([N+](=O)[O-])c2c1O |
| InChI | InChI=1S/C8H3Br2N3O5/c9-2-1-3-4(6(5(2)10)12(15)16)7(14)8(11-3)13(17)18/h1,11,14H |
| InChIKey | IXMMBRGXTLMCIY-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 122.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.94 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|