C7H3Br2NO5 — CID 10593300
4,6-dibromo-3-hydroxy-2-nitrobenzoic acid (PubChem CID 10593300) has the molecular formula C7H3Br2NO5 and a molecular weight of 340.91 g/mol. Its IUPAC name is 4,6-dibromo-3-hydroxy-2-nitrobenzoic acid.
| Compound Name | 4,6-dibromo-3-hydroxy-2-nitrobenzoic acid |
|---|---|
| PubChem CID | 10593300 |
| Molecular Formula | C7H3Br2NO5 |
| Molecular Weight | 340.91 g/mol |
| Exact Mass | 338.84 |
| IUPAC Name | 4,6-dibromo-3-hydroxy-2-nitrobenzoic acid |
| SMILES | O=C(O)c1c(Br)cc(Br)c(O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H3Br2NO5/c8-2-1-3(9)6(11)5(10(14)15)4(2)7(12)13/h1,11H,(H,12,13) |
| InChIKey | GVPABBXTZOHVHB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.91 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|