C9H3Br2N3O5 — CID 23354489
7,8-dibromo-6-nitro-1H-1,4-benzodiazepine-2,3,5-trione (PubChem CID 23354489) has the molecular formula C9H3Br2N3O5 and a molecular weight of 392.95 g/mol. Its IUPAC name is 7,8-dibromo-6-nitro-1H-1,4-benzodiazepine-2,3,5-trione.
| Compound Name | 7,8-dibromo-6-nitro-1H-1,4-benzodiazepine-2,3,5-trione |
|---|---|
| PubChem CID | 23354489 |
| Molecular Formula | C9H3Br2N3O5 |
| Molecular Weight | 392.95 g/mol |
| Exact Mass | 390.84 |
| IUPAC Name | 7,8-dibromo-6-nitro-1H-1,4-benzodiazepine-2,3,5-trione |
| SMILES | O=c1[nH]c(=O)c2c([N+](=O)[O-])c(Br)c(Br)cc2[nH]c1=O |
| InChI | InChI=1S/C9H3Br2N3O5/c10-2-1-3-4(6(5(2)11)14(18)19)7(15)13-9(17)8(16)12-3/h1H,(H2,12,13,15,16,17) |
| InChIKey | HNOLWQUGQGJYFK-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 125.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.95 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|