C11H11BrN3O7P — CID 54088943
7-bromo-5-(dimethoxyphosphorylmethyl)-6-nitro-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 54088943) has the molecular formula C11H11BrN3O7P and a molecular weight of 408.10 g/mol. Its IUPAC name is 7-bromo-5-(dimethoxyphosphorylmethyl)-6-nitro-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 7-bromo-5-(dimethoxyphosphorylmethyl)-6-nitro-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 54088943 |
| Molecular Formula | C11H11BrN3O7P |
| Molecular Weight | 408.10 g/mol |
| Exact Mass | 406.95 |
| IUPAC Name | 7-bromo-5-(dimethoxyphosphorylmethyl)-6-nitro-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | COP(=O)(Cc1c([N+](=O)[O-])c(Br)cc2[nH]c(=O)c(=O)[nH]c12)OC |
| InChI | InChI=1S/C11H11BrN3O7P/c1-21-23(20,22-2)4-5-8-7(13-10(16)11(17)14-8)3-6(12)9(5)15(18)19/h3H,4H2,1-2H3,(H,13,16)(H,14,17) |
| InChIKey | MSMQUAGLERRHNB-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 144.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.10 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|