C10H9BrN2O2 — CID 21189943
7-bromo-5-ethyl-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 21189943) has the molecular formula C10H9BrN2O2 and a molecular weight of 269.10 g/mol. Its IUPAC name is 7-bromo-5-ethyl-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 7-bromo-5-ethyl-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 21189943 |
| Molecular Formula | C10H9BrN2O2 |
| Molecular Weight | 269.10 g/mol |
| Exact Mass | 267.98 |
| IUPAC Name | 7-bromo-5-ethyl-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | CCc1cc(Br)cc2[nH]c(=O)c(=O)[nH]c12 |
| InChI | InChI=1S/C10H9BrN2O2/c1-2-5-3-6(11)4-7-8(5)13-10(15)9(14)12-7/h3-4H,2H2,1H3,(H,12,14)(H,13,15) |
| InChIKey | POSWUJQVDLNNSZ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.10 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|