C13H13BrN2O4S — CID 54172080
ethyl 2-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylsulfanyl]acetate (PubChem CID 54172080) has the molecular formula C13H13BrN2O4S and a molecular weight of 373.23 g/mol. Its IUPAC name is ethyl 2-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylsulfanyl]acetate.
| Compound Name | ethyl 2-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylsulfanyl]acetate |
|---|---|
| PubChem CID | 54172080 |
| Molecular Formula | C13H13BrN2O4S |
| Molecular Weight | 373.23 g/mol |
| Exact Mass | 371.98 |
| IUPAC Name | ethyl 2-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylsulfanyl]acetate |
| SMILES | CCOC(=O)CSCc1cc(Br)cc2[nH]c(=O)c(=O)[nH]c12 |
| InChI | InChI=1S/C13H13BrN2O4S/c1-2-20-10(17)6-21-5-7-3-8(14)4-9-11(7)16-13(19)12(18)15-9/h3-4H,2,5-6H2,1H3,(H,15,18)(H,16,19) |
| InChIKey | OVSIGOBKQOKMOI-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 92.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.23 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|