C17H20BrN3O4 — CID 54370238
ethyl 1-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]piperidine-4-carboxylate (PubChem CID 54370238) has the molecular formula C17H20BrN3O4 and a molecular weight of 410.27 g/mol. Its IUPAC name is ethyl 1-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 54370238 |
| Molecular Formula | C17H20BrN3O4 |
| Molecular Weight | 410.27 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | ethyl 1-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(Cc2cc(Br)cc3[nH]c(=O)c(=O)[nH]c23)CC1 |
| InChI | InChI=1S/C17H20BrN3O4/c1-2-25-17(24)10-3-5-21(6-4-10)9-11-7-12(18)8-13-14(11)20-16(23)15(22)19-13/h7-8,10H,2-6,9H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | USRHOWIGDQKLBN-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 95.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|