C13H14BrN3O4 — CID 174395689
2-amino-5-(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)pentanoic acid (PubChem CID 174395689) has the molecular formula C13H14BrN3O4 and a molecular weight of 356.18 g/mol. Its IUPAC name is 2-amino-5-(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)pentanoic acid.
| Compound Name | 2-amino-5-(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)pentanoic acid |
|---|---|
| PubChem CID | 174395689 |
| Molecular Formula | C13H14BrN3O4 |
| Molecular Weight | 356.18 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | 2-amino-5-(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)pentanoic acid |
| SMILES | NC(CCCc1cc(Br)cc2[nH]c(=O)c(=O)[nH]c12)C(=O)O |
| InChI | InChI=1S/C13H14BrN3O4/c14-7-4-6(2-1-3-8(15)13(20)21)10-9(5-7)16-11(18)12(19)17-10/h4-5,8H,1-3,15H2,(H,16,18)(H,17,19)(H,20,21) |
| InChIKey | XOIKQHQIIWHXDU-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 129.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.18 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|