C7H11N3O4 — CID 46238223
(2R)-2-amino-5-(4-oxo-1,2,5-oxadiazol-3-yl)pentanoic acid (PubChem CID 46238223) has the molecular formula C7H11N3O4 and a molecular weight of 201.18 g/mol. Its IUPAC name is (2R)-2-amino-5-(4-oxo-1,2,5-oxadiazol-3-yl)pentanoic acid.
| Compound Name | (2R)-2-amino-5-(4-oxo-1,2,5-oxadiazol-3-yl)pentanoic acid |
|---|---|
| PubChem CID | 46238223 |
| Molecular Formula | C7H11N3O4 |
| Molecular Weight | 201.18 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | (2R)-2-amino-5-(4-oxo-1,2,5-oxadiazol-3-yl)pentanoic acid |
| SMILES | N[C@H](CCCc1no[nH]c1=O)C(=O)O |
| InChI | InChI=1S/C7H11N3O4/c8-4(7(12)13)2-1-3-5-6(11)10-14-9-5/h4H,1-3,8H2,(H,10,11)(H,12,13)/t4-/m1/s1 |
| InChIKey | JYPYAECWCSLQCE-SCSAIBSYSA-N |
| XLogP | -0.90 |
| TPSA | 122.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.18 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |