C15H18BrN3O5 — CID 174442451
2-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]-4-hydroxy-3,3-dimethylbutanoic acid (PubChem CID 174442451) has the molecular formula C15H18BrN3O5 and a molecular weight of 400.23 g/mol. Its IUPAC name is 2-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]-4-hydroxy-3,3-dimethylbutanoic acid.
| Compound Name | 2-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]-4-hydroxy-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 174442451 |
| Molecular Formula | C15H18BrN3O5 |
| Molecular Weight | 400.23 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | 2-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]-4-hydroxy-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(CO)C(NCc1cc(Br)cc2[nH]c(=O)c(=O)[nH]c12)C(=O)O |
| InChI | InChI=1S/C15H18BrN3O5/c1-15(2,6-20)11(14(23)24)17-5-7-3-8(16)4-9-10(7)19-13(22)12(21)18-9/h3-4,11,17,20H,5-6H2,1-2H3,(H,18,21)(H,19,22)(H,23,24) |
| InChIKey | YDLQHANFEMXJJP-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 135.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.23 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|