C17H14BrN3O3S — CID 18706778
2-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylsulfanyl]-N-phenylacetamide (PubChem CID 18706778) has the molecular formula C17H14BrN3O3S and a molecular weight of 420.29 g/mol. Its IUPAC name is 2-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylsulfanyl]-N-phenylacetamide.
| Compound Name | 2-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylsulfanyl]-N-phenylacetamide |
|---|---|
| PubChem CID | 18706778 |
| Molecular Formula | C17H14BrN3O3S |
| Molecular Weight | 420.29 g/mol |
| Exact Mass | 418.99 |
| IUPAC Name | 2-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylsulfanyl]-N-phenylacetamide |
| SMILES | O=C(CSCc1cc(Br)cc2[nH]c(=O)c(=O)[nH]c12)Nc1ccccc1 |
| InChI | InChI=1S/C17H14BrN3O3S/c18-11-6-10(15-13(7-11)20-16(23)17(24)21-15)8-25-9-14(22)19-12-4-2-1-3-5-12/h1-7H,8-9H2,(H,19,22)(H,20,23)(H,21,24) |
| InChIKey | VMIRSRZSOZYIAB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.29 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|