C21H19BrN2O3S2 — CID 1280042
2-[(2-bromophenyl)methylsulfanyl]-N-[4-(phenylsulfamoyl)phenyl]acetamide (PubChem CID 1280042) has the molecular formula C21H19BrN2O3S2 and a molecular weight of 491.43 g/mol. Its IUPAC name is 2-[(2-bromophenyl)methylsulfanyl]-N-[4-(phenylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-[(2-bromophenyl)methylsulfanyl]-N-[4-(phenylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 1280042 |
| Molecular Formula | C21H19BrN2O3S2 |
| Molecular Weight | 491.43 g/mol |
| Exact Mass | 490.00 |
| IUPAC Name | 2-[(2-bromophenyl)methylsulfanyl]-N-[4-(phenylsulfamoyl)phenyl]acetamide |
| SMILES | O=C(CSCc1ccccc1Br)Nc1ccc(S(=O)(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C21H19BrN2O3S2/c22-20-9-5-4-6-16(20)14-28-15-21(25)23-17-10-12-19(13-11-17)29(26,27)24-18-7-2-1-3-8-18/h1-13,24H,14-15H2,(H,23,25) |
| InChIKey | BZARYCCUGNOAAY-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.43 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |