C21H18ClFN2O3S2 — CID 3931148
2-[(2-chloro-6-fluorophenyl)methylsulfanyl]-N-[4-(phenylsulfamoyl)phenyl]acetamide (PubChem CID 3931148) has the molecular formula C21H18ClFN2O3S2 and a molecular weight of 464.97 g/mol. Its IUPAC name is 2-[(2-chloro-6-fluorophenyl)methylsulfanyl]-N-[4-(phenylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-[(2-chloro-6-fluorophenyl)methylsulfanyl]-N-[4-(phenylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 3931148 |
| Molecular Formula | C21H18ClFN2O3S2 |
| Molecular Weight | 464.97 g/mol |
| Exact Mass | 464.04 |
| IUPAC Name | 2-[(2-chloro-6-fluorophenyl)methylsulfanyl]-N-[4-(phenylsulfamoyl)phenyl]acetamide |
| SMILES | O=C(CSCc1c(F)cccc1Cl)Nc1ccc(S(=O)(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C21H18ClFN2O3S2/c22-19-7-4-8-20(23)18(19)13-29-14-21(26)24-15-9-11-17(12-10-15)30(27,28)25-16-5-2-1-3-6-16/h1-12,25H,13-14H2,(H,24,26) |
| InChIKey | LMRLBGQTOJIKLP-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.97 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |