C16H14ClFN2O2S — CID 53278977
3-[[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]acetyl]amino]benzamide (PubChem CID 53278977) has the molecular formula C16H14ClFN2O2S and a molecular weight of 352.82 g/mol. Its IUPAC name is 3-[[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]acetyl]amino]benzamide.
| Compound Name | 3-[[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 53278977 |
| Molecular Formula | C16H14ClFN2O2S |
| Molecular Weight | 352.82 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | 3-[[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]acetyl]amino]benzamide |
| SMILES | NC(=O)c1cccc(NC(=O)CSCc2c(F)cccc2Cl)c1 |
| InChI | InChI=1S/C16H14ClFN2O2S/c17-13-5-2-6-14(18)12(13)8-23-9-15(21)20-11-4-1-3-10(7-11)16(19)22/h1-7H,8-9H2,(H2,19,22)(H,20,21) |
| InChIKey | QVXYCFCQSHFAAS-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.82 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |