C26H24N2O3S2 — CID 1278407
2-[(2-methylphenyl)methylsulfanyl]-N-[4-(naphthalen-1-ylsulfamoyl)phenyl]acetamide (PubChem CID 1278407) has the molecular formula C26H24N2O3S2 and a molecular weight of 476.62 g/mol. Its IUPAC name is 2-[(2-methylphenyl)methylsulfanyl]-N-[4-(naphthalen-1-ylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-[(2-methylphenyl)methylsulfanyl]-N-[4-(naphthalen-1-ylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 1278407 |
| Molecular Formula | C26H24N2O3S2 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | 2-[(2-methylphenyl)methylsulfanyl]-N-[4-(naphthalen-1-ylsulfamoyl)phenyl]acetamide |
| SMILES | Cc1ccccc1CSCC(=O)Nc1ccc(S(=O)(=O)Nc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C26H24N2O3S2/c1-19-7-2-3-9-21(19)17-32-18-26(29)27-22-13-15-23(16-14-22)33(30,31)28-25-12-6-10-20-8-4-5-11-24(20)25/h2-16,28H,17-18H2,1H3,(H,27,29) |
| InChIKey | JHOLTUMXQUZINI-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |