C18H16N2O4S — CID 1149220
methyl N-[4-(naphthalen-1-ylsulfamoyl)phenyl]carbamate (PubChem CID 1149220) has the molecular formula C18H16N2O4S and a molecular weight of 356.40 g/mol. Its IUPAC name is methyl N-[4-(naphthalen-1-ylsulfamoyl)phenyl]carbamate.
| Compound Name | methyl N-[4-(naphthalen-1-ylsulfamoyl)phenyl]carbamate |
|---|---|
| PubChem CID | 1149220 |
| Molecular Formula | C18H16N2O4S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | methyl N-[4-(naphthalen-1-ylsulfamoyl)phenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(S(=O)(=O)Nc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C18H16N2O4S/c1-24-18(21)19-14-9-11-15(12-10-14)25(22,23)20-17-8-4-6-13-5-2-3-7-16(13)17/h2-12,20H,1H3,(H,19,21) |
| InChIKey | MTHLREPFXUFVIV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |