C14H11BrN4O4S — CID 18706608
2-[2-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]-1,3-thiazol-4-yl]acetic acid (PubChem CID 18706608) has the molecular formula C14H11BrN4O4S and a molecular weight of 411.24 g/mol. Its IUPAC name is 2-[2-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 18706608 |
| Molecular Formula | C14H11BrN4O4S |
| Molecular Weight | 411.24 g/mol |
| Exact Mass | 409.97 |
| IUPAC Name | 2-[2-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]-1,3-thiazol-4-yl]acetic acid |
| SMILES | O=C(O)Cc1csc(NCc2cc(Br)cc3[nH]c(=O)c(=O)[nH]c23)n1 |
| InChI | InChI=1S/C14H11BrN4O4S/c15-7-1-6(11-9(2-7)18-12(22)13(23)19-11)4-16-14-17-8(5-24-14)3-10(20)21/h1-2,5H,3-4H2,(H,16,17)(H,18,22)(H,19,23)(H,20,21) |
| InChIKey | MQKHKLAIZHBCPL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 127.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.24 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|