C16H14N2O3S — CID 9148727
2-[2-[(2-hydroxynaphthalen-1-yl)methylamino]-1,3-thiazol-4-yl]acetic acid (PubChem CID 9148727) has the molecular formula C16H14N2O3S and a molecular weight of 314.37 g/mol. Its IUPAC name is 2-[2-[(2-hydroxynaphthalen-1-yl)methylamino]-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-[(2-hydroxynaphthalen-1-yl)methylamino]-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 9148727 |
| Molecular Formula | C16H14N2O3S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 2-[2-[(2-hydroxynaphthalen-1-yl)methylamino]-1,3-thiazol-4-yl]acetic acid |
| SMILES | O=C(O)Cc1csc(NCc2c(O)ccc3ccccc23)n1 |
| InChI | InChI=1S/C16H14N2O3S/c19-14-6-5-10-3-1-2-4-12(10)13(14)8-17-16-18-11(9-22-16)7-15(20)21/h1-6,9,19H,7-8H2,(H,17,18)(H,20,21) |
| InChIKey | RYJROOMFTGXGLM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|