C13H13FN2O2S — CID 80575585
2-[2-[2-(2-fluorophenyl)ethylamino]-1,3-thiazol-4-yl]acetic acid (PubChem CID 80575585) has the molecular formula C13H13FN2O2S and a molecular weight of 280.32 g/mol. Its IUPAC name is 2-[2-[2-(2-fluorophenyl)ethylamino]-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-[2-(2-fluorophenyl)ethylamino]-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 80575585 |
| Molecular Formula | C13H13FN2O2S |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 2-[2-[2-(2-fluorophenyl)ethylamino]-1,3-thiazol-4-yl]acetic acid |
| SMILES | O=C(O)Cc1csc(NCCc2ccccc2F)n1 |
| InChI | InChI=1S/C13H13FN2O2S/c14-11-4-2-1-3-9(11)5-6-15-13-16-10(8-19-13)7-12(17)18/h1-4,8H,5-7H2,(H,15,16)(H,17,18) |
| InChIKey | WVVAZEFYVBYRBF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |