C15H17BrN4O5 — CID 174395215
6-[amino-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]amino]-6-oxohexanoic acid (PubChem CID 174395215) has the molecular formula C15H17BrN4O5 and a molecular weight of 413.23 g/mol. Its IUPAC name is 6-[amino-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]amino]-6-oxohexanoic acid.
| Compound Name | 6-[amino-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]amino]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 174395215 |
| Molecular Formula | C15H17BrN4O5 |
| Molecular Weight | 413.23 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | 6-[amino-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]amino]-6-oxohexanoic acid |
| SMILES | NN(Cc1cc(Br)cc2[nH]c(=O)c(=O)[nH]c12)C(=O)CCCCC(=O)O |
| InChI | InChI=1S/C15H17BrN4O5/c16-9-5-8(13-10(6-9)18-14(24)15(25)19-13)7-20(17)11(21)3-1-2-4-12(22)23/h5-6H,1-4,7,17H2,(H,18,24)(H,19,25)(H,22,23) |
| InChIKey | BIRRYUSHJGAIOH-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 149.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.23 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|