C10H5Br2N3O6 — CID 19958598
2-(6,7-dibromo-5-nitro-2,3-dioxo-4H-quinoxalin-1-yl)acetic acid (PubChem CID 19958598) has the molecular formula C10H5Br2N3O6 and a molecular weight of 422.97 g/mol. Its IUPAC name is 2-(6,7-dibromo-5-nitro-2,3-dioxo-4H-quinoxalin-1-yl)acetic acid.
| Compound Name | 2-(6,7-dibromo-5-nitro-2,3-dioxo-4H-quinoxalin-1-yl)acetic acid |
|---|---|
| PubChem CID | 19958598 |
| Molecular Formula | C10H5Br2N3O6 |
| Molecular Weight | 422.97 g/mol |
| Exact Mass | 420.85 |
| IUPAC Name | 2-(6,7-dibromo-5-nitro-2,3-dioxo-4H-quinoxalin-1-yl)acetic acid |
| SMILES | O=C(O)Cn1c(=O)c(=O)[nH]c2c([N+](=O)[O-])c(Br)c(Br)cc21 |
| InChI | InChI=1S/C10H5Br2N3O6/c11-3-1-4-7(8(6(3)12)15(20)21)13-9(18)10(19)14(4)2-5(16)17/h1H,2H2,(H,13,18)(H,16,17) |
| InChIKey | KPHUTWOVRWLBRQ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 135.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.97 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|