C15H18BrN5O6 — CID 67627216
(2S)-6-amino-2-[(7-bromo-8-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]hexanoic acid (PubChem CID 67627216) has the molecular formula C15H18BrN5O6 and a molecular weight of 444.24 g/mol. Its IUPAC name is (2S)-6-amino-2-[(7-bromo-8-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[(7-bromo-8-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]hexanoic acid |
|---|---|
| PubChem CID | 67627216 |
| Molecular Formula | C15H18BrN5O6 |
| Molecular Weight | 444.24 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | (2S)-6-amino-2-[(7-bromo-8-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]hexanoic acid |
| SMILES | NCCCC[C@H](NCc1cc(Br)c([N+](=O)[O-])c2[nH]c(=O)c(=O)[nH]c12)C(=O)O |
| InChI | InChI=1S/C15H18BrN5O6/c16-8-5-7(6-18-9(15(24)25)3-1-2-4-17)10-11(12(8)21(26)27)20-14(23)13(22)19-10/h5,9,18H,1-4,6,17H2,(H,19,22)(H,20,23)(H,24,25)/t9-/m0/s1 |
| InChIKey | OAYMULOMVSQUTG-VIFPVBQESA-N |
| XLogP | 0.56 |
| TPSA | 184.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.24 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|