C10H7BrN2O4 — CID 19808443
2-(6-bromo-2,3-dioxo-4H-quinoxalin-1-yl)acetic acid (PubChem CID 19808443) has the molecular formula C10H7BrN2O4 and a molecular weight of 299.08 g/mol. Its IUPAC name is 2-(6-bromo-2,3-dioxo-4H-quinoxalin-1-yl)acetic acid.
| Compound Name | 2-(6-bromo-2,3-dioxo-4H-quinoxalin-1-yl)acetic acid |
|---|---|
| PubChem CID | 19808443 |
| Molecular Formula | C10H7BrN2O4 |
| Molecular Weight | 299.08 g/mol |
| Exact Mass | 297.96 |
| IUPAC Name | 2-(6-bromo-2,3-dioxo-4H-quinoxalin-1-yl)acetic acid |
| SMILES | O=C(O)Cn1c(=O)c(=O)[nH]c2cc(Br)ccc21 |
| InChI | InChI=1S/C10H7BrN2O4/c11-5-1-2-7-6(3-5)12-9(16)10(17)13(7)4-8(14)15/h1-3H,4H2,(H,12,16)(H,14,15) |
| InChIKey | YJGVOAJNRFCEKD-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.08 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|