C13H16Br2ClN5O3 — CID 135144665
2-(5,6-dibromo-4-nitro-2-piperazin-1-ylbenzimidazol-1-yl)ethanol;hydrochloride (PubChem CID 135144665) has the molecular formula C13H16Br2ClN5O3 and a molecular weight of 485.56 g/mol. Its IUPAC name is 2-(5,6-dibromo-4-nitro-2-piperazin-1-ylbenzimidazol-1-yl)ethanol;hydrochloride.
| Compound Name | 2-(5,6-dibromo-4-nitro-2-piperazin-1-ylbenzimidazol-1-yl)ethanol;hydrochloride |
|---|---|
| PubChem CID | 135144665 |
| Molecular Formula | C13H16Br2ClN5O3 |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 482.93 |
| IUPAC Name | 2-(5,6-dibromo-4-nitro-2-piperazin-1-ylbenzimidazol-1-yl)ethanol;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1c(Br)c(Br)cc2c1nc(N1CCNCC1)n2CCO |
| InChI | InChI=1S/C13H15Br2N5O3.ClH/c14-8-7-9-11(12(10(8)15)20(22)23)17-13(19(9)5-6-21)18-3-1-16-2-4-18;/h7,16,21H,1-6H2;1H |
| InChIKey | MZTXDGVXBIVEGV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 96.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|