C14H19Br2ClN6O2 — CID 118524551
3-(5,6-dibromo-4-nitro-2-piperazin-1-ylbenzimidazol-1-yl)propan-1-amine;hydrochloride (PubChem CID 118524551) has the molecular formula C14H19Br2ClN6O2 and a molecular weight of 498.61 g/mol. Its IUPAC name is 3-(5,6-dibromo-4-nitro-2-piperazin-1-ylbenzimidazol-1-yl)propan-1-amine;hydrochloride.
| Compound Name | 3-(5,6-dibromo-4-nitro-2-piperazin-1-ylbenzimidazol-1-yl)propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 118524551 |
| Molecular Formula | C14H19Br2ClN6O2 |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 495.96 |
| IUPAC Name | 3-(5,6-dibromo-4-nitro-2-piperazin-1-ylbenzimidazol-1-yl)propan-1-amine;hydrochloride |
| SMILES | Cl.NCCCn1c(N2CCNCC2)nc2c([N+](=O)[O-])c(Br)c(Br)cc21 |
| InChI | InChI=1S/C14H18Br2N6O2.ClH/c15-9-8-10-12(13(11(9)16)22(23)24)19-14(21(10)5-1-2-17)20-6-3-18-4-7-20;/h8,18H,1-7,17H2;1H |
| InChIKey | TUFXQUAMRZEKMD-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 102.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|