C17H24Br2ClN5O2 — CID 135144664
N-(azepan-4-yl)-5,6-dibromo-1-(2-methylpropyl)-4-nitrobenzimidazol-2-amine;hydrochloride (PubChem CID 135144664) has the molecular formula C17H24Br2ClN5O2 and a molecular weight of 525.67 g/mol. Its IUPAC name is N-(azepan-4-yl)-5,6-dibromo-1-(2-methylpropyl)-4-nitrobenzimidazol-2-amine;hydrochloride.
| Compound Name | N-(azepan-4-yl)-5,6-dibromo-1-(2-methylpropyl)-4-nitrobenzimidazol-2-amine;hydrochloride |
|---|---|
| PubChem CID | 135144664 |
| Molecular Formula | C17H24Br2ClN5O2 |
| Molecular Weight | 525.67 g/mol |
| Exact Mass | 523.00 |
| IUPAC Name | N-(azepan-4-yl)-5,6-dibromo-1-(2-methylpropyl)-4-nitrobenzimidazol-2-amine;hydrochloride |
| SMILES | CC(C)Cn1c(NC2CCCNCC2)nc2c([N+](=O)[O-])c(Br)c(Br)cc21.Cl |
| InChI | InChI=1S/C17H23Br2N5O2.ClH/c1-10(2)9-23-13-8-12(18)14(19)16(24(25)26)15(13)22-17(23)21-11-4-3-6-20-7-5-11;/h8,10-11,20H,3-7,9H2,1-2H3,(H,21,22);1H |
| InChIKey | JZHRTKCISBTJCM-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.67 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|