C16H20Br2N4O3 — CID 118524591
[1-(5,6-dibromo-4-nitro-1-propan-2-ylbenzimidazol-2-yl)piperidin-3-yl]methanol (PubChem CID 118524591) has the molecular formula C16H20Br2N4O3 and a molecular weight of 476.17 g/mol. Its IUPAC name is [1-(5,6-dibromo-4-nitro-1-propan-2-ylbenzimidazol-2-yl)piperidin-3-yl]methanol.
| Compound Name | [1-(5,6-dibromo-4-nitro-1-propan-2-ylbenzimidazol-2-yl)piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 118524591 |
| Molecular Formula | C16H20Br2N4O3 |
| Molecular Weight | 476.17 g/mol |
| Exact Mass | 473.99 |
| IUPAC Name | [1-(5,6-dibromo-4-nitro-1-propan-2-ylbenzimidazol-2-yl)piperidin-3-yl]methanol |
| SMILES | CC(C)n1c(N2CCCC(CO)C2)nc2c([N+](=O)[O-])c(Br)c(Br)cc21 |
| InChI | InChI=1S/C16H20Br2N4O3/c1-9(2)21-12-6-11(17)13(18)15(22(24)25)14(12)19-16(21)20-5-3-4-10(7-20)8-23/h6,9-10,23H,3-5,7-8H2,1-2H3 |
| InChIKey | LCIIJKIWDRRWBI-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 84.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.17 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|