C14H18BrClFN5O2 — CID 135144696
(3R)-1-(5-bromo-6-fluoro-4-nitro-1-propan-2-ylbenzimidazol-2-yl)pyrrolidin-3-amine;hydrochloride (PubChem CID 135144696) has the molecular formula C14H18BrClFN5O2 and a molecular weight of 422.69 g/mol. Its IUPAC name is (3R)-1-(5-bromo-6-fluoro-4-nitro-1-propan-2-ylbenzimidazol-2-yl)pyrrolidin-3-amine;hydrochloride.
| Compound Name | (3R)-1-(5-bromo-6-fluoro-4-nitro-1-propan-2-ylbenzimidazol-2-yl)pyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 135144696 |
| Molecular Formula | C14H18BrClFN5O2 |
| Molecular Weight | 422.69 g/mol |
| Exact Mass | 421.03 |
| IUPAC Name | (3R)-1-(5-bromo-6-fluoro-4-nitro-1-propan-2-ylbenzimidazol-2-yl)pyrrolidin-3-amine;hydrochloride |
| SMILES | CC(C)n1c(N2CC[C@@H](N)C2)nc2c([N+](=O)[O-])c(Br)c(F)cc21.Cl |
| InChI | InChI=1S/C14H17BrFN5O2.ClH/c1-7(2)20-10-5-9(16)11(15)13(21(22)23)12(10)18-14(20)19-4-3-8(17)6-19;/h5,7-8H,3-4,6,17H2,1-2H3;1H/t8-;/m1./s1 |
| InChIKey | KQGQPBMABFUMQG-DDWIOCJRSA-N |
| XLogP | 3.39 |
| TPSA | 90.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.69 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|