C14H17Cl2N5O2 — CID 162138792
1-(5,6-dichloro-1-ethyl-4-nitrobenzimidazol-2-yl)piperidin-3-amine (PubChem CID 162138792) has the molecular formula C14H17Cl2N5O2 and a molecular weight of 358.23 g/mol. Its IUPAC name is 1-(5,6-dichloro-1-ethyl-4-nitrobenzimidazol-2-yl)piperidin-3-amine.
| Compound Name | 1-(5,6-dichloro-1-ethyl-4-nitrobenzimidazol-2-yl)piperidin-3-amine |
|---|---|
| PubChem CID | 162138792 |
| Molecular Formula | C14H17Cl2N5O2 |
| Molecular Weight | 358.23 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 1-(5,6-dichloro-1-ethyl-4-nitrobenzimidazol-2-yl)piperidin-3-amine |
| SMILES | CCn1c(N2CCCC(N)C2)nc2c([N+](=O)[O-])c(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C14H17Cl2N5O2/c1-2-20-10-6-9(15)11(16)13(21(22)23)12(10)18-14(20)19-5-3-4-8(17)7-19/h6,8H,2-5,7,17H2,1H3 |
| InChIKey | YHFYMERYXXPFEH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 90.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.23 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|