C15H20Br2ClN5O2 — CID 135144719
1-(5,6-dibromo-4-nitro-1-propan-2-ylbenzimidazol-2-yl)piperidin-3-amine;hydrochloride (PubChem CID 135144719) has the molecular formula C15H20Br2ClN5O2 and a molecular weight of 497.62 g/mol. Its IUPAC name is 1-(5,6-dibromo-4-nitro-1-propan-2-ylbenzimidazol-2-yl)piperidin-3-amine;hydrochloride.
| Compound Name | 1-(5,6-dibromo-4-nitro-1-propan-2-ylbenzimidazol-2-yl)piperidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 135144719 |
| Molecular Formula | C15H20Br2ClN5O2 |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 494.97 |
| IUPAC Name | 1-(5,6-dibromo-4-nitro-1-propan-2-ylbenzimidazol-2-yl)piperidin-3-amine;hydrochloride |
| SMILES | CC(C)n1c(N2CCCC(N)C2)nc2c([N+](=O)[O-])c(Br)c(Br)cc21.Cl |
| InChI | InChI=1S/C15H19Br2N5O2.ClH/c1-8(2)21-11-6-10(16)12(17)14(22(23)24)13(11)19-15(21)20-5-3-4-9(18)7-20;/h6,8-9H,3-5,7,18H2,1-2H3;1H |
| InChIKey | UOUIQQPVDNMASW-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 90.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|