C14H19Br2N5O3 — CID 118524570
N-[2-(2-aminoethoxy)ethyl]-5,6-dibromo-4-nitro-1-propan-2-ylbenzimidazol-2-amine (PubChem CID 118524570) has the molecular formula C14H19Br2N5O3 and a molecular weight of 465.15 g/mol. Its IUPAC name is N-[2-(2-aminoethoxy)ethyl]-5,6-dibromo-4-nitro-1-propan-2-ylbenzimidazol-2-amine.
| Compound Name | N-[2-(2-aminoethoxy)ethyl]-5,6-dibromo-4-nitro-1-propan-2-ylbenzimidazol-2-amine |
|---|---|
| PubChem CID | 118524570 |
| Molecular Formula | C14H19Br2N5O3 |
| Molecular Weight | 465.15 g/mol |
| Exact Mass | 462.99 |
| IUPAC Name | N-[2-(2-aminoethoxy)ethyl]-5,6-dibromo-4-nitro-1-propan-2-ylbenzimidazol-2-amine |
| SMILES | CC(C)n1c(NCCOCCN)nc2c([N+](=O)[O-])c(Br)c(Br)cc21 |
| InChI | InChI=1S/C14H19Br2N5O3/c1-8(2)20-10-7-9(15)11(16)13(21(22)23)12(10)19-14(20)18-4-6-24-5-3-17/h7-8H,3-6,17H2,1-2H3,(H,18,19) |
| InChIKey | VEUJBQGQVQPDMG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 108.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.15 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|