C18H26Br2N6O2 — CID 118524579
5,6-dibromo-N-[[1-[2-(dimethylamino)ethyl]pyrrolidin-3-yl]methyl]-1-ethyl-4-nitrobenzimidazol-2-amine (PubChem CID 118524579) has the molecular formula C18H26Br2N6O2 and a molecular weight of 518.25 g/mol. Its IUPAC name is 5,6-dibromo-N-[[1-[2-(dimethylamino)ethyl]pyrrolidin-3-yl]methyl]-1-ethyl-4-nitrobenzimidazol-2-amine.
| Compound Name | 5,6-dibromo-N-[[1-[2-(dimethylamino)ethyl]pyrrolidin-3-yl]methyl]-1-ethyl-4-nitrobenzimidazol-2-amine |
|---|---|
| PubChem CID | 118524579 |
| Molecular Formula | C18H26Br2N6O2 |
| Molecular Weight | 518.25 g/mol |
| Exact Mass | 516.05 |
| IUPAC Name | 5,6-dibromo-N-[[1-[2-(dimethylamino)ethyl]pyrrolidin-3-yl]methyl]-1-ethyl-4-nitrobenzimidazol-2-amine |
| SMILES | CCn1c(NCC2CCN(CCN(C)C)C2)nc2c([N+](=O)[O-])c(Br)c(Br)cc21 |
| InChI | InChI=1S/C18H26Br2N6O2/c1-4-25-14-9-13(19)15(20)17(26(27)28)16(14)22-18(25)21-10-12-5-6-24(11-12)8-7-23(2)3/h9,12H,4-8,10-11H2,1-3H3,(H,21,22) |
| InChIKey | ZJJCWPPFKNWKTO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.25 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|