C14H17Br2N5O2 — CID 129174661
5,6-dibromo-4-nitro-1-propan-2-yl-N-pyrrolidin-2-ylbenzimidazol-2-amine (PubChem CID 129174661) has the molecular formula C14H17Br2N5O2 and a molecular weight of 447.13 g/mol. Its IUPAC name is 5,6-dibromo-4-nitro-1-propan-2-yl-N-pyrrolidin-2-ylbenzimidazol-2-amine.
| Compound Name | 5,6-dibromo-4-nitro-1-propan-2-yl-N-pyrrolidin-2-ylbenzimidazol-2-amine |
|---|---|
| PubChem CID | 129174661 |
| Molecular Formula | C14H17Br2N5O2 |
| Molecular Weight | 447.13 g/mol |
| Exact Mass | 444.97 |
| IUPAC Name | 5,6-dibromo-4-nitro-1-propan-2-yl-N-pyrrolidin-2-ylbenzimidazol-2-amine |
| SMILES | CC(C)n1c(NC2CCCN2)nc2c([N+](=O)[O-])c(Br)c(Br)cc21 |
| InChI | InChI=1S/C14H17Br2N5O2/c1-7(2)20-9-6-8(15)11(16)13(21(22)23)12(9)19-14(20)18-10-4-3-5-17-10/h6-7,10,17H,3-5H2,1-2H3,(H,18,19) |
| InChIKey | GOPPYVQKSMLBPK-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.13 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|