C16H10Br6N4O5 — CID 157181444
1,2,4-tribromo-5-nitrobenzene;1-(2,5,6-tribromo-4-nitrobenzimidazol-1-yl)propan-2-ol (PubChem CID 157181444) has the molecular formula C16H10Br6N4O5 and a molecular weight of 817.70 g/mol. Its IUPAC name is 1,2,4-tribromo-5-nitrobenzene;1-(2,5,6-tribromo-4-nitrobenzimidazol-1-yl)propan-2-ol.
| Compound Name | 1,2,4-tribromo-5-nitrobenzene;1-(2,5,6-tribromo-4-nitrobenzimidazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 157181444 |
| Molecular Formula | C16H10Br6N4O5 |
| Molecular Weight | 817.70 g/mol |
| Exact Mass | 811.58 |
| IUPAC Name | 1,2,4-tribromo-5-nitrobenzene;1-(2,5,6-tribromo-4-nitrobenzimidazol-1-yl)propan-2-ol |
| SMILES | CC(O)Cn1c(Br)nc2c([N+](=O)[O-])c(Br)c(Br)cc21.O=[N+]([O-])c1cc(Br)c(Br)cc1Br |
| InChI | InChI=1S/C10H8Br3N3O3.C6H2Br3NO2/c1-4(17)3-15-6-2-5(11)7(12)9(16(18)19)8(6)14-10(15)13;7-3-1-5(9)6(10(11)12)2-4(3)8/h2,4,17H,3H2,1H3;1-2H |
| InChIKey | AOPPPXHDFWTVBJ-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 124.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.70 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|